C12H16N4O3 — CID 25171903
1-[(2R,4R,5S,6S)-4-hydroxy-8-oxo-1,7-diazatricyclo[7.3.0.02,6]dodeca-9,11-dien-5-yl]-3-methylurea (PubChem CID 25171903) has the molecular formula C12H16N4O3 and a molecular weight of 264.29 g/mol. Its IUPAC name is 1-[(2R,4R,5S,6S)-4-hydroxy-8-oxo-1,7-diazatricyclo[7.3.0.02,6]dodeca-9,11-dien-5-yl]-3-methylurea.
| Compound Name | 1-[(2R,4R,5S,6S)-4-hydroxy-8-oxo-1,7-diazatricyclo[7.3.0.02,6]dodeca-9,11-dien-5-yl]-3-methylurea |
|---|---|
| PubChem CID | 25171903 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1-[(2R,4R,5S,6S)-4-hydroxy-8-oxo-1,7-diazatricyclo[7.3.0.02,6]dodeca-9,11-dien-5-yl]-3-methylurea |
| SMILES | CNC(=O)N[C@H]1[C@@H]2NC(=O)c3cccn3[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C12H16N4O3/c1-13-12(19)15-10-8(17)5-7-9(10)14-11(18)6-3-2-4-16(6)7/h2-4,7-10,17H,5H2,1H3,(H,14,18)(H2,13,15,19)/t7-,8-,9-,10-/m1/s1 |
| InChIKey | VCHHGERELUHHSJ-ZYUZMQFOSA-N |
| XLogP | -0.80 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |