C20H32O7 — CID 25171909
(3S,4S,6R,9R)-9-hydroxy-4-methoxy-6-(methoxymethoxy)-3-phenylmethoxydecanoic acid (PubChem CID 25171909) has the molecular formula C20H32O7 and a molecular weight of 384.47 g/mol. Its IUPAC name is (3S,4S,6R,9R)-9-hydroxy-4-methoxy-6-(methoxymethoxy)-3-phenylmethoxydecanoic acid.
| Compound Name | (3S,4S,6R,9R)-9-hydroxy-4-methoxy-6-(methoxymethoxy)-3-phenylmethoxydecanoic acid |
|---|---|
| PubChem CID | 25171909 |
| Molecular Formula | C20H32O7 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | (3S,4S,6R,9R)-9-hydroxy-4-methoxy-6-(methoxymethoxy)-3-phenylmethoxydecanoic acid |
| SMILES | COCO[C@H](CC[C@@H](C)O)C[C@H](OC)[C@H](CC(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C20H32O7/c1-15(21)9-10-17(27-14-24-2)11-18(25-3)19(12-20(22)23)26-13-16-7-5-4-6-8-16/h4-8,15,17-19,21H,9-14H2,1-3H3,(H,22,23)/t15-,17-,18+,19+/m1/s1 |
| InChIKey | XOUUVBUWGDPIKF-YSHGAJCASA-N |
| XLogP | 2.60 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|