C22H20BNO3 — CID 25171964
(3aS,11cR)-2-[2-[(1R)-1-methoxyethyl]phenyl]-3a,11c-dihydro-[1,3,2]dioxaborolo[4,5-k]phenanthridine (PubChem CID 25171964) has the molecular formula C22H20BNO3 and a molecular weight of 357.22 g/mol. Its IUPAC name is (3aS,11cR)-2-[2-[(1R)-1-methoxyethyl]phenyl]-3a,11c-dihydro-[1,3,2]dioxaborolo[4,5-k]phenanthridine.
| Compound Name | (3aS,11cR)-2-[2-[(1R)-1-methoxyethyl]phenyl]-3a,11c-dihydro-[1,3,2]dioxaborolo[4,5-k]phenanthridine |
|---|---|
| PubChem CID | 25171964 |
| Molecular Formula | C22H20BNO3 |
| Molecular Weight | 357.22 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | (3aS,11cR)-2-[2-[(1R)-1-methoxyethyl]phenyl]-3a,11c-dihydro-[1,3,2]dioxaborolo[4,5-k]phenanthridine |
| SMILES | CO[C@H](C)c1ccccc1B1O[C@H]2C=Cc3cnc4ccccc4c3[C@H]2O1 |
| InChI | InChI=1S/C22H20BNO3/c1-14(25-2)16-7-3-5-9-18(16)23-26-20-12-11-15-13-24-19-10-6-4-8-17(19)21(15)22(20)27-23/h3-14,20,22H,1-2H3/t14-,20+,22+/m1/s1 |
| InChIKey | YAVQTEKMUNZHJF-XDCJIHQESA-N |
| XLogP | 3.82 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.22 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|