C13H26N2O4S — CID 25172005
(2R)-2,4-dihydroxy-3,3-dimethyl-N-[3-(3-methylsulfanylpropylamino)-3-oxopropyl]butanamide (PubChem CID 25172005) has the molecular formula C13H26N2O4S and a molecular weight of 306.43 g/mol. Its IUPAC name is (2R)-2,4-dihydroxy-3,3-dimethyl-N-[3-(3-methylsulfanylpropylamino)-3-oxopropyl]butanamide.
| Compound Name | (2R)-2,4-dihydroxy-3,3-dimethyl-N-[3-(3-methylsulfanylpropylamino)-3-oxopropyl]butanamide |
|---|---|
| PubChem CID | 25172005 |
| Molecular Formula | C13H26N2O4S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (2R)-2,4-dihydroxy-3,3-dimethyl-N-[3-(3-methylsulfanylpropylamino)-3-oxopropyl]butanamide |
| SMILES | CSCCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)CO |
| InChI | InChI=1S/C13H26N2O4S/c1-13(2,9-16)11(18)12(19)15-7-5-10(17)14-6-4-8-20-3/h11,16,18H,4-9H2,1-3H3,(H,14,17)(H,15,19)/t11-/m0/s1 |
| InChIKey | FSFNPBBVPNCHBM-NSHDSACASA-N |
| XLogP | -0.26 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|