C27H24ClNO6 — CID 25172056
(2S,3'Z,5'R)-7-chloro-3'-hydroxyimino-4,6-dimethoxy-5'-methyl-1'-(naphthalen-1-ylmethoxy)spiro[1-benzofuran-2,6'-cyclohexene]-3-one (PubChem CID 25172056) has the molecular formula C27H24ClNO6 and a molecular weight of 493.94 g/mol. Its IUPAC name is (2S,3'Z,5'R)-7-chloro-3'-hydroxyimino-4,6-dimethoxy-5'-methyl-1'-(naphthalen-1-ylmethoxy)spiro[1-benzofuran-2,6'-cyclohexene]-3-one.
| Compound Name | (2S,3'Z,5'R)-7-chloro-3'-hydroxyimino-4,6-dimethoxy-5'-methyl-1'-(naphthalen-1-ylmethoxy)spiro[1-benzofuran-2,6'-cyclohexene]-3-one |
|---|---|
| PubChem CID | 25172056 |
| Molecular Formula | C27H24ClNO6 |
| Molecular Weight | 493.94 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | (2S,3'Z,5'R)-7-chloro-3'-hydroxyimino-4,6-dimethoxy-5'-methyl-1'-(naphthalen-1-ylmethoxy)spiro[1-benzofuran-2,6'-cyclohexene]-3-one |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@]1(C2=O)C(OCc2cccc3ccccc23)=C/C(=N\O)C[C@H]1C |
| InChI | InChI=1S/C27H24ClNO6/c1-15-11-18(29-31)12-22(34-14-17-9-6-8-16-7-4-5-10-19(16)17)27(15)26(30)23-20(32-2)13-21(33-3)24(28)25(23)35-27/h4-10,12-13,15,31H,11,14H2,1-3H3/b29-18-/t15-,27+/m1/s1 |
| InChIKey | QLEKTANOUAJACT-BLUNBCLOSA-N |
| XLogP | 5.80 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.94 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|