C7H7Br3O5 — CID 25172330
2-[(2S,4S)-4-methyl-5-oxo-2-(tribromomethyl)-1,3-dioxolan-4-yl]acetic acid (PubChem CID 25172330) has the molecular formula C7H7Br3O5 and a molecular weight of 410.84 g/mol. Its IUPAC name is 2-[(2S,4S)-4-methyl-5-oxo-2-(tribromomethyl)-1,3-dioxolan-4-yl]acetic acid.
| Compound Name | 2-[(2S,4S)-4-methyl-5-oxo-2-(tribromomethyl)-1,3-dioxolan-4-yl]acetic acid |
|---|---|
| PubChem CID | 25172330 |
| Molecular Formula | C7H7Br3O5 |
| Molecular Weight | 410.84 g/mol |
| Exact Mass | 407.78 |
| IUPAC Name | 2-[(2S,4S)-4-methyl-5-oxo-2-(tribromomethyl)-1,3-dioxolan-4-yl]acetic acid |
| SMILES | C[C@@]1(CC(=O)O)O[C@H](C(Br)(Br)Br)OC1=O |
| InChI | InChI=1S/C7H7Br3O5/c1-6(2-3(11)12)4(13)14-5(15-6)7(8,9)10/h5H,2H2,1H3,(H,11,12)/t5-,6+/m1/s1 |
| InChIKey | DQBDKLZRVAYYJU-RITPCOANSA-N |
| XLogP | 1.96 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.84 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|