C12H17NO — CID 25172533
(11aS)-1,2,3,6,7,9,10,11-octahydropyrrolo[2,1-j]quinolin-5-one (PubChem CID 25172533) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (11aS)-1,2,3,6,7,9,10,11-octahydropyrrolo[2,1-j]quinolin-5-one.
| Compound Name | (11aS)-1,2,3,6,7,9,10,11-octahydropyrrolo[2,1-j]quinolin-5-one |
|---|---|
| PubChem CID | 25172533 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (11aS)-1,2,3,6,7,9,10,11-octahydropyrrolo[2,1-j]quinolin-5-one |
| SMILES | O=C1CCC2=CCCC[C@]23CCCN13 |
| InChI | InChI=1S/C12H17NO/c14-11-6-5-10-4-1-2-7-12(10)8-3-9-13(11)12/h4H,1-3,5-9H2/t12-/m0/s1 |
| InChIKey | ZKJJVOZZOKPEFF-LBPRGKRZSA-N |
| XLogP | 2.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|