C25H28N8O2 — CID 25172962
4-[[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethylamino]-3,4-dioxocyclobuten-1-yl]amino]benzonitrile (PubChem CID 25172962) has the molecular formula C25H28N8O2 and a molecular weight of 472.55 g/mol. Its IUPAC name is 4-[[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethylamino]-3,4-dioxocyclobuten-1-yl]amino]benzonitrile.
| Compound Name | 4-[[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethylamino]-3,4-dioxocyclobuten-1-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 25172962 |
| Molecular Formula | C25H28N8O2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 4-[[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethylamino]-3,4-dioxocyclobuten-1-yl]amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2c(NCCNc3cc(N4CCCC4)nc(N4CCCC4)n3)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C25H28N8O2/c26-16-17-5-7-18(8-6-17)29-22-21(23(34)24(22)35)28-10-9-27-19-15-20(32-11-1-2-12-32)31-25(30-19)33-13-3-4-14-33/h5-8,15,28-29H,1-4,9-14H2,(H,27,30,31) |
| InChIKey | MWRKUALHWRZJQN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 126.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|