About 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylic acid
3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylic acid (PubChem CID 25172989) has the molecular formula C26H21FN2O2
and a molecular weight of 412.46 g/mol. Its IUPAC name is 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylic acid |
| PubChem CID | 25172989 |
| Molecular Formula | C26H21FN2O2 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylic acid |
| SMILES | Cc1[nH]c2ccc3c(c(-c4ccccc4F)c(C(=O)O)n3Cc3ccccc3)c2c1C |
| InChI | InChI=1S/C26H21FN2O2/c1-15-16(2)28-20-12-13-21-24(22(15)20)23(18-10-6-7-11-19(18)27)25(26(30)31)29(21)14-17-8-4-3-5-9-17/h3-13,28H,14H2,1-2H3,(H,30,31) |
| InChIKey | OTEJQSASEQXMTC-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 58.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylic acid?
The IUPAC name of 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylic acid (CID 25172989) is 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylic acid.
What is the SMILES notation for 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylic acid?
The canonical SMILES for 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylic acid is Cc1[nH]c2ccc3c(c(-c4ccccc4F)c(C(=O)O)n3Cc3ccccc3)c2c1C.
What is the InChIKey of 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylic acid?
The InChIKey is OTEJQSASEQXMTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21FN2O2/c1-15-16(2)28-20-12-13-21-24(22(15)20)23(18-10-6-7-11-19(18)27)25(26(30)31)29(21)14-17-8-4-3-5-9-17/h3-13,28H,14H2,1-2H3,(H,30,31).
What are the key properties of 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylic acid?
3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylic acid has a molecular weight of 412.46 g/mol, XLogP of 6.29, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylic acid is sourced from PubChem (CID 25172989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).