About ethyl 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylate
ethyl 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylate (PubChem CID 25173067) has the molecular formula C28H25FN2O2
and a molecular weight of 440.52 g/mol. Its IUPAC name is ethyl 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylate |
| PubChem CID | 25173067 |
| Molecular Formula | C28H25FN2O2 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | ethyl 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2F)c2c3c(C)c(C)[nH]c3ccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C28H25FN2O2/c1-4-33-28(32)27-25(20-12-8-9-13-21(20)29)26-23(31(27)16-19-10-6-5-7-11-19)15-14-22-24(26)17(2)18(3)30-22/h5-15,30H,4,16H2,1-3H3 |
| InChIKey | VOYURPSPOZAKES-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylate?
The IUPAC name of ethyl 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylate (CID 25173067) is ethyl 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylate.
What is the SMILES notation for ethyl 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylate?
The canonical SMILES for ethyl 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylate is CCOC(=O)c1c(-c2ccccc2F)c2c3c(C)c(C)[nH]c3ccc2n1Cc1ccccc1.
What is the InChIKey of ethyl 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylate?
The InChIKey is VOYURPSPOZAKES-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H25FN2O2/c1-4-33-28(32)27-25(20-12-8-9-13-21(20)29)26-23(31(27)16-19-10-6-5-7-11-19)15-14-22-24(26)17(2)18(3)30-22/h5-15,30H,4,16H2,1-3H3.
What are the key properties of ethyl 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylate?
ethyl 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylate has a molecular weight of 440.52 g/mol, XLogP of 6.77, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-benzyl-1-(2-fluorophenyl)-7,8-dimethyl-6H-pyrrolo[3,2-e]indole-2-carboxylate is sourced from PubChem (CID 25173067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).