About 3-[[4-(2-cyclohexylethoxy)phenyl]methyl]-5-methyl-1,3-oxazolidin-2-one
3-[[4-(2-cyclohexylethoxy)phenyl]methyl]-5-methyl-1,3-oxazolidin-2-one (PubChem CID 25173287) has the molecular formula C19H27NO3
and a molecular weight of 317.43 g/mol. Its IUPAC name is 3-[[4-(2-cyclohexylethoxy)phenyl]methyl]-5-methyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-[[4-(2-cyclohexylethoxy)phenyl]methyl]-5-methyl-1,3-oxazolidin-2-one |
| PubChem CID | 25173287 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 3-[[4-(2-cyclohexylethoxy)phenyl]methyl]-5-methyl-1,3-oxazolidin-2-one |
| SMILES | CC1CN(Cc2ccc(OCCC3CCCCC3)cc2)C(=O)O1 |
| InChI | InChI=1S/C19H27NO3/c1-15-13-20(19(21)23-15)14-17-7-9-18(10-8-17)22-12-11-16-5-3-2-4-6-16/h7-10,15-16H,2-6,11-14H2,1H3 |
| InChIKey | BBOKFBYMJJGGLL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[4-(2-cyclohexylethoxy)phenyl]methyl]-5-methyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(2-cyclohexylethoxy)phenyl]methyl]-5-methyl-1,3-oxazolidin-2-one?
The IUPAC name of 3-[[4-(2-cyclohexylethoxy)phenyl]methyl]-5-methyl-1,3-oxazolidin-2-one (CID 25173287) is 3-[[4-(2-cyclohexylethoxy)phenyl]methyl]-5-methyl-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-[[4-(2-cyclohexylethoxy)phenyl]methyl]-5-methyl-1,3-oxazolidin-2-one?
The canonical SMILES for 3-[[4-(2-cyclohexylethoxy)phenyl]methyl]-5-methyl-1,3-oxazolidin-2-one is CC1CN(Cc2ccc(OCCC3CCCCC3)cc2)C(=O)O1.
What is the InChIKey of 3-[[4-(2-cyclohexylethoxy)phenyl]methyl]-5-methyl-1,3-oxazolidin-2-one?
The InChIKey is BBOKFBYMJJGGLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27NO3/c1-15-13-20(19(21)23-15)14-17-7-9-18(10-8-17)22-12-11-16-5-3-2-4-6-16/h7-10,15-16H,2-6,11-14H2,1H3.
What are the key properties of 3-[[4-(2-cyclohexylethoxy)phenyl]methyl]-5-methyl-1,3-oxazolidin-2-one?
3-[[4-(2-cyclohexylethoxy)phenyl]methyl]-5-methyl-1,3-oxazolidin-2-one has a molecular weight of 317.43 g/mol, XLogP of 4.38, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(2-cyclohexylethoxy)phenyl]methyl]-5-methyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 25173287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).