About 3-[[4-(1-cyclohexylethoxy)phenyl]methyl]-5,5-dimethyl-1,3-oxazinan-2-one
3-[[4-(1-cyclohexylethoxy)phenyl]methyl]-5,5-dimethyl-1,3-oxazinan-2-one (PubChem CID 25173615) has the molecular formula C21H31NO3
and a molecular weight of 345.48 g/mol. Its IUPAC name is 3-[[4-(1-cyclohexylethoxy)phenyl]methyl]-5,5-dimethyl-1,3-oxazinan-2-one.
Molecular Properties
| Compound Name | 3-[[4-(1-cyclohexylethoxy)phenyl]methyl]-5,5-dimethyl-1,3-oxazinan-2-one |
| PubChem CID | 25173615 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 3-[[4-(1-cyclohexylethoxy)phenyl]methyl]-5,5-dimethyl-1,3-oxazinan-2-one |
| SMILES | CC(Oc1ccc(CN2CC(C)(C)COC2=O)cc1)C1CCCCC1 |
| InChI | InChI=1S/C21H31NO3/c1-16(18-7-5-4-6-8-18)25-19-11-9-17(10-12-19)13-22-14-21(2,3)15-24-20(22)23/h9-12,16,18H,4-8,13-15H2,1-3H3 |
| InChIKey | BCTCOHTYEHBWBB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[4-(1-cyclohexylethoxy)phenyl]methyl]-5,5-dimethyl-1,3-oxazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(1-cyclohexylethoxy)phenyl]methyl]-5,5-dimethyl-1,3-oxazinan-2-one?
The IUPAC name of 3-[[4-(1-cyclohexylethoxy)phenyl]methyl]-5,5-dimethyl-1,3-oxazinan-2-one (CID 25173615) is 3-[[4-(1-cyclohexylethoxy)phenyl]methyl]-5,5-dimethyl-1,3-oxazinan-2-one.
What is the SMILES notation for 3-[[4-(1-cyclohexylethoxy)phenyl]methyl]-5,5-dimethyl-1,3-oxazinan-2-one?
The canonical SMILES for 3-[[4-(1-cyclohexylethoxy)phenyl]methyl]-5,5-dimethyl-1,3-oxazinan-2-one is CC(Oc1ccc(CN2CC(C)(C)COC2=O)cc1)C1CCCCC1.
What is the InChIKey of 3-[[4-(1-cyclohexylethoxy)phenyl]methyl]-5,5-dimethyl-1,3-oxazinan-2-one?
The InChIKey is BCTCOHTYEHBWBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31NO3/c1-16(18-7-5-4-6-8-18)25-19-11-9-17(10-12-19)13-22-14-21(2,3)15-24-20(22)23/h9-12,16,18H,4-8,13-15H2,1-3H3.
What are the key properties of 3-[[4-(1-cyclohexylethoxy)phenyl]methyl]-5,5-dimethyl-1,3-oxazinan-2-one?
3-[[4-(1-cyclohexylethoxy)phenyl]methyl]-5,5-dimethyl-1,3-oxazinan-2-one has a molecular weight of 345.48 g/mol, XLogP of 5.01, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(1-cyclohexylethoxy)phenyl]methyl]-5,5-dimethyl-1,3-oxazinan-2-one is sourced from PubChem (CID 25173615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).