C17H16N2O2 — CID 25175386
N-[(4-methoxyphenyl)methyl]-5-phenyl-1,3-oxazol-2-amine (PubChem CID 25175386) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-5-phenyl-1,3-oxazol-2-amine.
| Compound Name | N-[(4-methoxyphenyl)methyl]-5-phenyl-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 25175386 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-5-phenyl-1,3-oxazol-2-amine |
| SMILES | COc1ccc(CNc2ncc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C17H16N2O2/c1-20-15-9-7-13(8-10-15)11-18-17-19-12-16(21-17)14-5-3-2-4-6-14/h2-10,12H,11H2,1H3,(H,18,19) |
| InChIKey | WCAWHTOTCQHSBF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |