C31H36F2N6O2 — CID 25175718
N-[5-[2-(3,5-difluorophenyl)propan-2-yl]-1H-indazol-3-yl]-2-(2-methoxyethylamino)-4-(4-methylpiperazin-1-yl)benzamide (PubChem CID 25175718) has the molecular formula C31H36F2N6O2 and a molecular weight of 562.67 g/mol. Its IUPAC name is N-[5-[2-(3,5-difluorophenyl)propan-2-yl]-1H-indazol-3-yl]-2-(2-methoxyethylamino)-4-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | N-[5-[2-(3,5-difluorophenyl)propan-2-yl]-1H-indazol-3-yl]-2-(2-methoxyethylamino)-4-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 25175718 |
| Molecular Formula | C31H36F2N6O2 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | N-[5-[2-(3,5-difluorophenyl)propan-2-yl]-1H-indazol-3-yl]-2-(2-methoxyethylamino)-4-(4-methylpiperazin-1-yl)benzamide |
| SMILES | COCCNc1cc(N2CCN(C)CC2)ccc1C(=O)Nc1n[nH]c2ccc(C(C)(C)c3cc(F)cc(F)c3)cc12 |
| InChI | InChI=1S/C31H36F2N6O2/c1-31(2,21-15-22(32)18-23(33)16-21)20-5-8-27-26(17-20)29(37-36-27)35-30(40)25-7-6-24(19-28(25)34-9-14-41-4)39-12-10-38(3)11-13-39/h5-8,15-19,34H,9-14H2,1-4H3,(H2,35,36,37,40) |
| InChIKey | YUDJHWUIASIUFJ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|