C17H14F3N3OS — CID 25175811
N-(2-ethylpyrazol-3-yl)-4-phenyl-5-(trifluoromethyl)thiophene-2-carboxamide (PubChem CID 25175811) has the molecular formula C17H14F3N3OS and a molecular weight of 365.38 g/mol. Its IUPAC name is N-(2-ethylpyrazol-3-yl)-4-phenyl-5-(trifluoromethyl)thiophene-2-carboxamide.
| Compound Name | N-(2-ethylpyrazol-3-yl)-4-phenyl-5-(trifluoromethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 25175811 |
| Molecular Formula | C17H14F3N3OS |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | N-(2-ethylpyrazol-3-yl)-4-phenyl-5-(trifluoromethyl)thiophene-2-carboxamide |
| SMILES | CCn1nccc1NC(=O)c1cc(-c2ccccc2)c(C(F)(F)F)s1 |
| InChI | InChI=1S/C17H14F3N3OS/c1-2-23-14(8-9-21-23)22-16(24)13-10-12(11-6-4-3-5-7-11)15(25-13)17(18,19)20/h3-10H,2H2,1H3,(H,22,24) |
| InChIKey | BDWDYSFTCKFBCG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |