C20H17F7N2O2 — CID 25175933
4-pyrrolidin-1-yl-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 25175933) has the molecular formula C20H17F7N2O2 and a molecular weight of 450.35 g/mol. Its IUPAC name is 4-pyrrolidin-1-yl-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | 4-pyrrolidin-1-yl-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 25175933 |
| Molecular Formula | C20H17F7N2O2 |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 4-pyrrolidin-1-yl-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1cccc(OC(F)(F)C(F)F)c1)c1ccc(N2CCCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H17F7N2O2/c21-18(22)20(26,27)31-14-5-3-4-13(11-14)28-17(30)12-6-7-16(29-8-1-2-9-29)15(10-12)19(23,24)25/h3-7,10-11,18H,1-2,8-9H2,(H,28,30) |
| InChIKey | XRLYOQUZFMGNLG-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|