C33H32F6N4O3S — CID 25175994
1-N-[(2S,3R)-4-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-3-hydroxy-1-phenylbutan-2-yl]-3-N-methyl-3-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzene-1,3-dicarboxamide (PubChem CID 25175994) has the molecular formula C33H32F6N4O3S and a molecular weight of 678.70 g/mol. Its IUPAC name is 1-N-[(2S,3R)-4-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-3-hydroxy-1-phenylbutan-2-yl]-3-N-methyl-3-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-4-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-3-hydroxy-1-phenylbutan-2-yl]-3-N-methyl-3-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 25175994 |
| Molecular Formula | C33H32F6N4O3S |
| Molecular Weight | 678.70 g/mol |
| Exact Mass | 678.21 |
| IUPAC Name | 1-N-[(2S,3R)-4-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-3-hydroxy-1-phenylbutan-2-yl]-3-N-methyl-3-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzene-1,3-dicarboxamide |
| SMILES | Cc1csc(CN(C)C(=O)c2cccc(C(=O)N[C@@H](Cc3ccccc3)[C@H](O)CNCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2)n1 |
| InChI | InChI=1S/C33H32F6N4O3S/c1-20-19-47-29(41-20)18-43(2)31(46)24-10-6-9-23(14-24)30(45)42-27(13-21-7-4-3-5-8-21)28(44)17-40-16-22-11-25(32(34,35)36)15-26(12-22)33(37,38)39/h3-12,14-15,19,27-28,40,44H,13,16-18H2,1-2H3,(H,42,45)/t27-,28+/m0/s1 |
| InChIKey | XDQIIFFIUBAMED-WUFINQPMSA-N |
| XLogP | 6.25 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.70 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |