C39H49FN4O11 — CID 25176226
[4-[4-[1-(3-fluorophenyl)pyrrolidin-3-yl]oxyphenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-yl] 2-(2-nitrooxyethoxy)ethyl carbonate (PubChem CID 25176226) has the molecular formula C39H49FN4O11 and a molecular weight of 768.84 g/mol. Its IUPAC name is [4-[4-[1-(3-fluorophenyl)pyrrolidin-3-yl]oxyphenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-yl] 2-(2-nitrooxyethoxy)ethyl carbonate.
| Compound Name | [4-[4-[1-(3-fluorophenyl)pyrrolidin-3-yl]oxyphenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-yl] 2-(2-nitrooxyethoxy)ethyl carbonate |
|---|---|
| PubChem CID | 25176226 |
| Molecular Formula | C39H49FN4O11 |
| Molecular Weight | 768.84 g/mol |
| Exact Mass | 768.34 |
| IUPAC Name | [4-[4-[1-(3-fluorophenyl)pyrrolidin-3-yl]oxyphenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-yl] 2-(2-nitrooxyethoxy)ethyl carbonate |
| SMILES | COCCCN1CCOc2ccc(COC3CNCC(OC(=O)OCCOCCO[N+](=O)[O-])C3c3ccc(OC4CCN(c5cccc(F)c5)C4)cc3)cc21 |
| InChI | InChI=1S/C39H49FN4O11/c1-48-16-3-13-42-15-17-50-35-11-6-28(22-34(35)42)27-52-36-24-41-25-37(55-39(45)51-20-18-49-19-21-53-44(46)47)38(36)29-7-9-32(10-8-29)54-33-12-14-43(26-33)31-5-2-4-30(40)23-31/h2,4-11,22-23,33,36-38,41H,3,12-21,24-27H2,1H3 |
| InChIKey | IDSCFGVCZLQLTF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 152.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.84 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|