C27H31FN2O3 — CID 25176242
2-[(3-fluorophenyl)methylamino]-1-[4-[4-(2-morpholin-4-ylethoxy)phenyl]phenyl]ethanol (PubChem CID 25176242) has the molecular formula C27H31FN2O3 and a molecular weight of 450.55 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methylamino]-1-[4-[4-(2-morpholin-4-ylethoxy)phenyl]phenyl]ethanol.
| Compound Name | 2-[(3-fluorophenyl)methylamino]-1-[4-[4-(2-morpholin-4-ylethoxy)phenyl]phenyl]ethanol |
|---|---|
| PubChem CID | 25176242 |
| Molecular Formula | C27H31FN2O3 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 2-[(3-fluorophenyl)methylamino]-1-[4-[4-(2-morpholin-4-ylethoxy)phenyl]phenyl]ethanol |
| SMILES | OC(CNCc1cccc(F)c1)c1ccc(-c2ccc(OCCN3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C27H31FN2O3/c28-25-3-1-2-21(18-25)19-29-20-27(31)24-6-4-22(5-7-24)23-8-10-26(11-9-23)33-17-14-30-12-15-32-16-13-30/h1-11,18,27,29,31H,12-17,19-20H2 |
| InChIKey | GCDHBJVLSYAPMF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |