C15H15Cl2N3O2 — CID 25176253
5-chloro-N-(3-chlorophenyl)-6-(2-methoxyethylamino)pyridine-3-carboxamide (PubChem CID 25176253) has the molecular formula C15H15Cl2N3O2 and a molecular weight of 340.21 g/mol. Its IUPAC name is 5-chloro-N-(3-chlorophenyl)-6-(2-methoxyethylamino)pyridine-3-carboxamide.
| Compound Name | 5-chloro-N-(3-chlorophenyl)-6-(2-methoxyethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 25176253 |
| Molecular Formula | C15H15Cl2N3O2 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 5-chloro-N-(3-chlorophenyl)-6-(2-methoxyethylamino)pyridine-3-carboxamide |
| SMILES | COCCNc1ncc(C(=O)Nc2cccc(Cl)c2)cc1Cl |
| InChI | InChI=1S/C15H15Cl2N3O2/c1-22-6-5-18-14-13(17)7-10(9-19-14)15(21)20-12-4-2-3-11(16)8-12/h2-4,7-9H,5-6H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | BDTNMELLIYVOBL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|