C30H38FN7O3 — CID 25176444
7-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-6-phenylpyrimidin-2-yl]amino]-4-(2-methoxyethyl)pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 25176444) has the molecular formula C30H38FN7O3 and a molecular weight of 563.68 g/mol. Its IUPAC name is 7-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-6-phenylpyrimidin-2-yl]amino]-4-(2-methoxyethyl)pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 7-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-6-phenylpyrimidin-2-yl]amino]-4-(2-methoxyethyl)pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 25176444 |
| Molecular Formula | C30H38FN7O3 |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.30 |
| IUPAC Name | 7-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-6-phenylpyrimidin-2-yl]amino]-4-(2-methoxyethyl)pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | COCCN1C(=O)COc2cc(Nc3nc(NC4CC(C)(C)N(C)C(C)(C)C4)c(F)c(-c4ccccc4)n3)cnc21 |
| InChI | InChI=1S/C30H38FN7O3/c1-29(2)15-21(16-30(3,4)37(29)5)33-26-24(31)25(19-10-8-7-9-11-19)35-28(36-26)34-20-14-22-27(32-17-20)38(12-13-40-6)23(39)18-41-22/h7-11,14,17,21H,12-13,15-16,18H2,1-6H3,(H2,33,34,35,36) |
| InChIKey | KGCGAMCEMRZUHU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |