C32H32ClFN6O2 — CID 25176846
N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[(2-morpholin-4-ylethylamino)methyl]pyrrol-1-yl]quinazolin-4-amine (PubChem CID 25176846) has the molecular formula C32H32ClFN6O2 and a molecular weight of 587.10 g/mol. Its IUPAC name is N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[(2-morpholin-4-ylethylamino)methyl]pyrrol-1-yl]quinazolin-4-amine.
| Compound Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[(2-morpholin-4-ylethylamino)methyl]pyrrol-1-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 25176846 |
| Molecular Formula | C32H32ClFN6O2 |
| Molecular Weight | 587.10 g/mol |
| Exact Mass | 586.23 |
| IUPAC Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[(2-morpholin-4-ylethylamino)methyl]pyrrol-1-yl]quinazolin-4-amine |
| SMILES | Fc1cccc(COc2ccc(Nc3ncnc4ccc(-n5cccc5CNCCN5CCOCC5)cc34)cc2Cl)c1 |
| InChI | InChI=1S/C32H32ClFN6O2/c33-29-18-25(6-9-31(29)42-21-23-3-1-4-24(34)17-23)38-32-28-19-26(7-8-30(28)36-22-37-32)40-11-2-5-27(40)20-35-10-12-39-13-15-41-16-14-39/h1-9,11,17-19,22,35H,10,12-16,20-21H2,(H,36,37,38) |
| InChIKey | ZAYKJXADYVPDDA-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.10 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|