C21H27ClN4O4 — CID 25177344
2-[(2S)-2-[(1R)-1-chloro-2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]-N-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide (PubChem CID 25177344) has the molecular formula C21H27ClN4O4 and a molecular weight of 434.92 g/mol. Its IUPAC name is 2-[(2S)-2-[(1R)-1-chloro-2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]-N-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide.
| Compound Name | 2-[(2S)-2-[(1R)-1-chloro-2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]-N-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 25177344 |
| Molecular Formula | C21H27ClN4O4 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 2-[(2S)-2-[(1R)-1-chloro-2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]-N-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide |
| SMILES | CNC(=O)C1Cc2c([nH]c3ccccc23)CN1C(=O)[C@H](CC(C)C)[C@@H](Cl)C(=O)NO |
| InChI | InChI=1S/C21H27ClN4O4/c1-11(2)8-14(18(22)20(28)25-30)21(29)26-10-16-13(9-17(26)19(27)23-3)12-6-4-5-7-15(12)24-16/h4-7,11,14,17-18,24,30H,8-10H2,1-3H3,(H,23,27)(H,25,28)/t14-,17?,18-/m1/s1 |
| InChIKey | YKJJZESWURXRAS-FHKHCFAMSA-N |
| XLogP | 1.94 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|