C19H28N4 — CID 25177631
N'-[(3,5-dimethyl-2-pyridinyl)methyl]-N'-(1-pyridin-2-ylethyl)butane-1,4-diamine (PubChem CID 25177631) has the molecular formula C19H28N4 and a molecular weight of 312.46 g/mol. Its IUPAC name is N'-[(3,5-dimethyl-2-pyridinyl)methyl]-N'-(1-pyridin-2-ylethyl)butane-1,4-diamine.
| Compound Name | N'-[(3,5-dimethyl-2-pyridinyl)methyl]-N'-(1-pyridin-2-ylethyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 25177631 |
| Molecular Formula | C19H28N4 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | N'-[(3,5-dimethyl-2-pyridinyl)methyl]-N'-(1-pyridin-2-ylethyl)butane-1,4-diamine |
| SMILES | Cc1cnc(CN(CCCCN)C(C)c2ccccn2)c(C)c1 |
| InChI | InChI=1S/C19H28N4/c1-15-12-16(2)19(22-13-15)14-23(11-7-5-9-20)17(3)18-8-4-6-10-21-18/h4,6,8,10,12-13,17H,5,7,9,11,14,20H2,1-3H3 |
| InChIKey | ZOSBGNJWLUKHGF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|