About N'-(1H-benzimidazol-2-ylmethyl)-N'-(1-pyridin-2-ylethyl)butane-1,4-diamine
N'-(1H-benzimidazol-2-ylmethyl)-N'-(1-pyridin-2-ylethyl)butane-1,4-diamine (PubChem CID 25177852) has the molecular formula C19H25N5
and a molecular weight of 323.44 g/mol. Its IUPAC name is N'-(1H-benzimidazol-2-ylmethyl)-N'-(1-pyridin-2-ylethyl)butane-1,4-diamine.
Molecular Properties
| Compound Name | N'-(1H-benzimidazol-2-ylmethyl)-N'-(1-pyridin-2-ylethyl)butane-1,4-diamine |
| PubChem CID | 25177852 |
| Molecular Formula | C19H25N5 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | N'-(1H-benzimidazol-2-ylmethyl)-N'-(1-pyridin-2-ylethyl)butane-1,4-diamine |
| SMILES | CC(c1ccccn1)N(CCCCN)Cc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H25N5/c1-15(16-8-4-6-12-21-16)24(13-7-5-11-20)14-19-22-17-9-2-3-10-18(17)23-19/h2-4,6,8-10,12,15H,5,7,11,13-14,20H2,1H3,(H,22,23) |
| InChIKey | OSZUXHNLRBBQOK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(1H-benzimidazol-2-ylmethyl)-N'-(1-pyridin-2-ylethyl)butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1H-benzimidazol-2-ylmethyl)-N'-(1-pyridin-2-ylethyl)butane-1,4-diamine?
The IUPAC name of N'-(1H-benzimidazol-2-ylmethyl)-N'-(1-pyridin-2-ylethyl)butane-1,4-diamine (CID 25177852) is N'-(1H-benzimidazol-2-ylmethyl)-N'-(1-pyridin-2-ylethyl)butane-1,4-diamine.
What is the SMILES notation for N'-(1H-benzimidazol-2-ylmethyl)-N'-(1-pyridin-2-ylethyl)butane-1,4-diamine?
The canonical SMILES for N'-(1H-benzimidazol-2-ylmethyl)-N'-(1-pyridin-2-ylethyl)butane-1,4-diamine is CC(c1ccccn1)N(CCCCN)Cc1nc2ccccc2[nH]1.
What is the InChIKey of N'-(1H-benzimidazol-2-ylmethyl)-N'-(1-pyridin-2-ylethyl)butane-1,4-diamine?
The InChIKey is OSZUXHNLRBBQOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N5/c1-15(16-8-4-6-12-21-16)24(13-7-5-11-20)14-19-22-17-9-2-3-10-18(17)23-19/h2-4,6,8-10,12,15H,5,7,11,13-14,20H2,1H3,(H,22,23).
What are the key properties of N'-(1H-benzimidazol-2-ylmethyl)-N'-(1-pyridin-2-ylethyl)butane-1,4-diamine?
N'-(1H-benzimidazol-2-ylmethyl)-N'-(1-pyridin-2-ylethyl)butane-1,4-diamine has a molecular weight of 323.44 g/mol, XLogP of 3.26, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1H-benzimidazol-2-ylmethyl)-N'-(1-pyridin-2-ylethyl)butane-1,4-diamine is sourced from PubChem (CID 25177852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).