C18H21NO6 — CID 25177957
(3aR,6S,7aR)-2,2-dimethyl-4'-(4-methylphenyl)spiro[4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6,6'-morpholine]-3',7-dione (PubChem CID 25177957) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is (3aR,6S,7aR)-2,2-dimethyl-4'-(4-methylphenyl)spiro[4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6,6'-morpholine]-3',7-dione.
| Compound Name | (3aR,6S,7aR)-2,2-dimethyl-4'-(4-methylphenyl)spiro[4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6,6'-morpholine]-3',7-dione |
|---|---|
| PubChem CID | 25177957 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | (3aR,6S,7aR)-2,2-dimethyl-4'-(4-methylphenyl)spiro[4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6,6'-morpholine]-3',7-dione |
| SMILES | Cc1ccc(N2C[C@@]3(OCC2=O)OC[C@H]2OC(C)(C)O[C@H]2C3=O)cc1 |
| InChI | InChI=1S/C18H21NO6/c1-11-4-6-12(7-5-11)19-10-18(23-9-14(19)20)16(21)15-13(8-22-18)24-17(2,3)25-15/h4-7,13,15H,8-10H2,1-3H3/t13-,15-,18+/m1/s1 |
| InChIKey | ULUGHPFHJGACJB-SIIHOXLZSA-N |
| XLogP | 1.17 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |