About 3,3-diphenyl-2H-1,4-oxazin-6-one
3,3-diphenyl-2H-1,4-oxazin-6-one (PubChem CID 25177993) has the molecular formula C16H13NO2
and a molecular weight of 251.29 g/mol. Its IUPAC name is 3,3-diphenyl-2H-1,4-oxazin-6-one.
Molecular Properties
| Compound Name | 3,3-diphenyl-2H-1,4-oxazin-6-one |
| PubChem CID | 25177993 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 3,3-diphenyl-2H-1,4-oxazin-6-one |
| SMILES | O=C1C=NC(c2ccccc2)(c2ccccc2)CO1 |
| InChI | InChI=1S/C16H13NO2/c18-15-11-17-16(12-19-15,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-11H,12H2 |
| InChIKey | TYAMILIOPHQLMZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3-diphenyl-2H-1,4-oxazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diphenyl-2H-1,4-oxazin-6-one?
The IUPAC name of 3,3-diphenyl-2H-1,4-oxazin-6-one (CID 25177993) is 3,3-diphenyl-2H-1,4-oxazin-6-one.
What is the SMILES notation for 3,3-diphenyl-2H-1,4-oxazin-6-one?
The canonical SMILES for 3,3-diphenyl-2H-1,4-oxazin-6-one is O=C1C=NC(c2ccccc2)(c2ccccc2)CO1.
What is the InChIKey of 3,3-diphenyl-2H-1,4-oxazin-6-one?
The InChIKey is TYAMILIOPHQLMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO2/c18-15-11-17-16(12-19-15,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-11H,12H2.
What are the key properties of 3,3-diphenyl-2H-1,4-oxazin-6-one?
3,3-diphenyl-2H-1,4-oxazin-6-one has a molecular weight of 251.29 g/mol, XLogP of 2.56, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diphenyl-2H-1,4-oxazin-6-one is sourced from PubChem (CID 25177993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).