C13H26Cl4N3O4PS — CID 25178048
2-[2-[bis[bis(2-chloroethyl)amino]phosphoryl]ethylsulfonyl]-N-methylacetamide (PubChem CID 25178048) has the molecular formula C13H26Cl4N3O4PS and a molecular weight of 493.22 g/mol. Its IUPAC name is 2-[2-[bis[bis(2-chloroethyl)amino]phosphoryl]ethylsulfonyl]-N-methylacetamide.
| Compound Name | 2-[2-[bis[bis(2-chloroethyl)amino]phosphoryl]ethylsulfonyl]-N-methylacetamide |
|---|---|
| PubChem CID | 25178048 |
| Molecular Formula | C13H26Cl4N3O4PS |
| Molecular Weight | 493.22 g/mol |
| Exact Mass | 491.01 |
| IUPAC Name | 2-[2-[bis[bis(2-chloroethyl)amino]phosphoryl]ethylsulfonyl]-N-methylacetamide |
| SMILES | CNC(=O)CS(=O)(=O)CCP(=O)(N(CCCl)CCCl)N(CCCl)CCCl |
| InChI | InChI=1S/C13H26Cl4N3O4PS/c1-18-13(21)12-26(23,24)11-10-25(22,19(6-2-14)7-3-15)20(8-4-16)9-5-17/h2-12H2,1H3,(H,18,21) |
| InChIKey | ZXJMMPTUADNZMI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|