About 3-anilino-5-methyl-7-(2-methylpropyl)-2H-pyrazolo[3,4-d]pyrimidine-4,6-dione
3-anilino-5-methyl-7-(2-methylpropyl)-2H-pyrazolo[3,4-d]pyrimidine-4,6-dione (PubChem CID 25178069) has the molecular formula C16H19N5O2
and a molecular weight of 313.36 g/mol. Its IUPAC name is 3-anilino-5-methyl-7-(2-methylpropyl)-2H-pyrazolo[3,4-d]pyrimidine-4,6-dione.
Molecular Properties
| Compound Name | 3-anilino-5-methyl-7-(2-methylpropyl)-2H-pyrazolo[3,4-d]pyrimidine-4,6-dione |
| PubChem CID | 25178069 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 3-anilino-5-methyl-7-(2-methylpropyl)-2H-pyrazolo[3,4-d]pyrimidine-4,6-dione |
| SMILES | CC(C)Cn1c(=O)n(C)c(=O)c2c(Nc3ccccc3)[nH]nc21 |
| InChI | InChI=1S/C16H19N5O2/c1-10(2)9-21-14-12(15(22)20(3)16(21)23)13(18-19-14)17-11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3,(H2,17,18,19) |
| InChIKey | HTENNXXGAZOEPC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-anilino-5-methyl-7-(2-methylpropyl)-2H-pyrazolo[3,4-d]pyrimidine-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-anilino-5-methyl-7-(2-methylpropyl)-2H-pyrazolo[3,4-d]pyrimidine-4,6-dione?
The IUPAC name of 3-anilino-5-methyl-7-(2-methylpropyl)-2H-pyrazolo[3,4-d]pyrimidine-4,6-dione (CID 25178069) is 3-anilino-5-methyl-7-(2-methylpropyl)-2H-pyrazolo[3,4-d]pyrimidine-4,6-dione.
What is the SMILES notation for 3-anilino-5-methyl-7-(2-methylpropyl)-2H-pyrazolo[3,4-d]pyrimidine-4,6-dione?
The canonical SMILES for 3-anilino-5-methyl-7-(2-methylpropyl)-2H-pyrazolo[3,4-d]pyrimidine-4,6-dione is CC(C)Cn1c(=O)n(C)c(=O)c2c(Nc3ccccc3)[nH]nc21.
What is the InChIKey of 3-anilino-5-methyl-7-(2-methylpropyl)-2H-pyrazolo[3,4-d]pyrimidine-4,6-dione?
The InChIKey is HTENNXXGAZOEPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N5O2/c1-10(2)9-21-14-12(15(22)20(3)16(21)23)13(18-19-14)17-11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3,(H2,17,18,19).
What are the key properties of 3-anilino-5-methyl-7-(2-methylpropyl)-2H-pyrazolo[3,4-d]pyrimidine-4,6-dione?
3-anilino-5-methyl-7-(2-methylpropyl)-2H-pyrazolo[3,4-d]pyrimidine-4,6-dione has a molecular weight of 313.36 g/mol, XLogP of 1.82, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-anilino-5-methyl-7-(2-methylpropyl)-2H-pyrazolo[3,4-d]pyrimidine-4,6-dione is sourced from PubChem (CID 25178069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).