C17H26N4S2 — CID 25178134
5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-ylmethyl N,N'-dicyclopentylcarbamimidothioate (PubChem CID 25178134) has the molecular formula C17H26N4S2 and a molecular weight of 350.56 g/mol. Its IUPAC name is 5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-ylmethyl N,N'-dicyclopentylcarbamimidothioate.
| Compound Name | 5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-ylmethyl N,N'-dicyclopentylcarbamimidothioate |
|---|---|
| PubChem CID | 25178134 |
| Molecular Formula | C17H26N4S2 |
| Molecular Weight | 350.56 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-ylmethyl N,N'-dicyclopentylcarbamimidothioate |
| SMILES | C1=C(CS/C(=N\C2CCCC2)NC2CCCC2)N2CCN=C2S1 |
| InChI | InChI=1S/C17H26N4S2/c1-2-6-13(5-1)19-16(20-14-7-3-4-8-14)22-11-15-12-23-17-18-9-10-21(15)17/h12-14H,1-11H2,(H,19,20) |
| InChIKey | MVAYOLUSHUJRDR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|