C21H34N4S2 — CID 25178136
5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-ylmethyl N,N'-di(cycloheptyl)carbamimidothioate (PubChem CID 25178136) has the molecular formula C21H34N4S2 and a molecular weight of 406.67 g/mol. Its IUPAC name is 5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-ylmethyl N,N'-di(cycloheptyl)carbamimidothioate.
| Compound Name | 5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-ylmethyl N,N'-di(cycloheptyl)carbamimidothioate |
|---|---|
| PubChem CID | 25178136 |
| Molecular Formula | C21H34N4S2 |
| Molecular Weight | 406.67 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-ylmethyl N,N'-di(cycloheptyl)carbamimidothioate |
| SMILES | C1=C(CS/C(=N\C2CCCCCC2)NC2CCCCCC2)N2CCN=C2S1 |
| InChI | InChI=1S/C21H34N4S2/c1-2-6-10-17(9-5-1)23-20(24-18-11-7-3-4-8-12-18)26-15-19-16-27-21-22-13-14-25(19)21/h16-18H,1-15H2,(H,23,24) |
| InChIKey | JCVDTZFSFHPHAJ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.67 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|