C18H30Cl2N4S2 — CID 25178139
5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-ylmethyl N-cyclohexyl-N'-cyclopentylcarbamimidothioate;dihydrochloride (PubChem CID 25178139) has the molecular formula C18H30Cl2N4S2 and a molecular weight of 437.51 g/mol. Its IUPAC name is 5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-ylmethyl N-cyclohexyl-N'-cyclopentylcarbamimidothioate;dihydrochloride.
| Compound Name | 5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-ylmethyl N-cyclohexyl-N'-cyclopentylcarbamimidothioate;dihydrochloride |
|---|---|
| PubChem CID | 25178139 |
| Molecular Formula | C18H30Cl2N4S2 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-ylmethyl N-cyclohexyl-N'-cyclopentylcarbamimidothioate;dihydrochloride |
| SMILES | C1=C(CS/C(=N\C2CCCC2)NC2CCCCC2)N2CCN=C2S1.Cl.Cl |
| InChI | InChI=1S/C18H28N4S2.2ClH/c1-2-6-14(7-3-1)20-17(21-15-8-4-5-9-15)23-12-16-13-24-18-19-10-11-22(16)18;;/h13-15H,1-12H2,(H,20,21);2*1H |
| InChIKey | FZDOSKMKPHJHFQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|