C24H29BrN2O3 — CID 25178151
2-(4-amino-3-bromophenyl)ethyl (1R,2S,3S,5S)-3-(4-methoxyphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 25178151) has the molecular formula C24H29BrN2O3 and a molecular weight of 473.41 g/mol. Its IUPAC name is 2-(4-amino-3-bromophenyl)ethyl (1R,2S,3S,5S)-3-(4-methoxyphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | 2-(4-amino-3-bromophenyl)ethyl (1R,2S,3S,5S)-3-(4-methoxyphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 25178151 |
| Molecular Formula | C24H29BrN2O3 |
| Molecular Weight | 473.41 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 2-(4-amino-3-bromophenyl)ethyl (1R,2S,3S,5S)-3-(4-methoxyphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COc1ccc([C@H]2C[C@@H]3CC[C@H]([C@H]2C(=O)OCCc2ccc(N)c(Br)c2)N3C)cc1 |
| InChI | InChI=1S/C24H29BrN2O3/c1-27-17-6-10-22(27)23(19(14-17)16-4-7-18(29-2)8-5-16)24(28)30-12-11-15-3-9-21(26)20(25)13-15/h3-5,7-9,13,17,19,22-23H,6,10-12,14,26H2,1-2H3/t17-,19+,22+,23-/m0/s1 |
| InChIKey | YWIOWZOQXGTXDJ-RECSWBGYSA-N |
| XLogP | 4.39 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|