C15H16O4S — CID 25178168
4-hydroxy-4-[4-(thiophen-2-ylmethoxy)phenyl]butanoic acid (PubChem CID 25178168) has the molecular formula C15H16O4S and a molecular weight of 292.36 g/mol. Its IUPAC name is 4-hydroxy-4-[4-(thiophen-2-ylmethoxy)phenyl]butanoic acid.
| Compound Name | 4-hydroxy-4-[4-(thiophen-2-ylmethoxy)phenyl]butanoic acid |
|---|---|
| PubChem CID | 25178168 |
| Molecular Formula | C15H16O4S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 4-hydroxy-4-[4-(thiophen-2-ylmethoxy)phenyl]butanoic acid |
| SMILES | O=C(O)CCC(O)c1ccc(OCc2cccs2)cc1 |
| InChI | InChI=1S/C15H16O4S/c16-14(7-8-15(17)18)11-3-5-12(6-4-11)19-10-13-2-1-9-20-13/h1-6,9,14,16H,7-8,10H2,(H,17,18) |
| InChIKey | QOFGEOGGXJZVJC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |