About 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-ene-4-thione
2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-ene-4-thione (PubChem CID 25178319) has the molecular formula C12H20N3OS+
and a molecular weight of 254.38 g/mol. Its IUPAC name is 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-ene-4-thione.
Molecular Properties
| Compound Name | 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-ene-4-thione |
| PubChem CID | 25178319 |
| Molecular Formula | C12H20N3OS+ |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-ene-4-thione |
| SMILES | S=C1NC(C2CCCCC2)=N[N+]12CCOCC2 |
| InChI | InChI=1S/C12H19N3OS/c17-12-13-11(10-4-2-1-3-5-10)14-15(12)6-8-16-9-7-15/h10H,1-9H2/p+1 |
| InChIKey | YDBNELBVRBPUHH-UHFFFAOYSA-O |
| XLogP | 1.62 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-ene-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-ene-4-thione?
The IUPAC name of 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-ene-4-thione (CID 25178319) is 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-ene-4-thione.
What is the SMILES notation for 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-ene-4-thione?
The canonical SMILES for 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-ene-4-thione is S=C1NC(C2CCCCC2)=N[N+]12CCOCC2.
What is the InChIKey of 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-ene-4-thione?
The InChIKey is YDBNELBVRBPUHH-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H19N3OS/c17-12-13-11(10-4-2-1-3-5-10)14-15(12)6-8-16-9-7-15/h10H,1-9H2/p+1.
What are the key properties of 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-ene-4-thione?
2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-ene-4-thione has a molecular weight of 254.38 g/mol, XLogP of 1.62, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-ene-4-thione is sourced from PubChem (CID 25178319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).