C14H18ClN5 — CID 25178340
7-chloro-N-methyl-2-(4-methylpiperazin-1-yl)quinazolin-4-amine (PubChem CID 25178340) has the molecular formula C14H18ClN5 and a molecular weight of 291.79 g/mol. Its IUPAC name is 7-chloro-N-methyl-2-(4-methylpiperazin-1-yl)quinazolin-4-amine.
| Compound Name | 7-chloro-N-methyl-2-(4-methylpiperazin-1-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 25178340 |
| Molecular Formula | C14H18ClN5 |
| Molecular Weight | 291.79 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 7-chloro-N-methyl-2-(4-methylpiperazin-1-yl)quinazolin-4-amine |
| SMILES | CNc1nc(N2CCN(C)CC2)nc2cc(Cl)ccc12 |
| InChI | InChI=1S/C14H18ClN5/c1-16-13-11-4-3-10(15)9-12(11)17-14(18-13)20-7-5-19(2)6-8-20/h3-4,9H,5-8H2,1-2H3,(H,16,17,18) |
| InChIKey | ZXHALLHEVZLUOS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.79 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |