C8H11ClN2S — CID 25178355
3-(chloromethyl)-6,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazole (PubChem CID 25178355) has the molecular formula C8H11ClN2S and a molecular weight of 202.71 g/mol. Its IUPAC name is 3-(chloromethyl)-6,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazole.
| Compound Name | 3-(chloromethyl)-6,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 25178355 |
| Molecular Formula | C8H11ClN2S |
| Molecular Weight | 202.71 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | 3-(chloromethyl)-6,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazole |
| SMILES | CC1(C)CN2C(CCl)=CSC2=N1 |
| InChI | InChI=1S/C8H11ClN2S/c1-8(2)5-11-6(3-9)4-12-7(11)10-8/h4H,3,5H2,1-2H3 |
| InChIKey | QCZJKWKRYIDOIX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.71 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|