About 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-en-4-one
2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-en-4-one (PubChem CID 25178529) has the molecular formula C12H20N3O2+
and a molecular weight of 238.31 g/mol. Its IUPAC name is 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-en-4-one.
Molecular Properties
| Compound Name | 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-en-4-one |
| PubChem CID | 25178529 |
| Molecular Formula | C12H20N3O2+ |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-en-4-one |
| SMILES | O=C1NC(C2CCCCC2)=N[N+]12CCOCC2 |
| InChI | InChI=1S/C12H19N3O2/c16-12-13-11(10-4-2-1-3-5-10)14-15(12)6-8-17-9-7-15/h10H,1-9H2/p+1 |
| InChIKey | KFYVMKRQKMGWRQ-UHFFFAOYSA-O |
| XLogP | 1.45 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-en-4-one?
The IUPAC name of 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-en-4-one (CID 25178529) is 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-en-4-one.
What is the SMILES notation for 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-en-4-one?
The canonical SMILES for 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-en-4-one is O=C1NC(C2CCCCC2)=N[N+]12CCOCC2.
What is the InChIKey of 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-en-4-one?
The InChIKey is KFYVMKRQKMGWRQ-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H19N3O2/c16-12-13-11(10-4-2-1-3-5-10)14-15(12)6-8-17-9-7-15/h10H,1-9H2/p+1.
What are the key properties of 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-en-4-one?
2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-en-4-one has a molecular weight of 238.31 g/mol, XLogP of 1.45, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-8-oxa-1,3-diaza-5-azoniaspiro[4.5]dec-1-en-4-one is sourced from PubChem (CID 25178529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).