C19H32N4S2 — CID 25178567
5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-ylmethyl N-cyclohexyl-N'-hexylcarbamimidothioate (PubChem CID 25178567) has the molecular formula C19H32N4S2 and a molecular weight of 380.63 g/mol. Its IUPAC name is 5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-ylmethyl N-cyclohexyl-N'-hexylcarbamimidothioate.
| Compound Name | 5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-ylmethyl N-cyclohexyl-N'-hexylcarbamimidothioate |
|---|---|
| PubChem CID | 25178567 |
| Molecular Formula | C19H32N4S2 |
| Molecular Weight | 380.63 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-ylmethyl N-cyclohexyl-N'-hexylcarbamimidothioate |
| SMILES | CCCCCC/N=C(/NC1CCCCC1)SCC1=CSC2=NCCN12 |
| InChI | InChI=1S/C19H32N4S2/c1-2-3-4-8-11-20-18(22-16-9-6-5-7-10-16)24-14-17-15-25-19-21-12-13-23(17)19/h15-16H,2-14H2,1H3,(H,20,22) |
| InChIKey | WCAVHXBYHAXEAP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.63 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|