C16H24O4S2 — CID 25178781
(2R,4R,5S,6R)-4-[bis(ethylsulfanyl)methyl]-6-(hydroxymethyl)-2-phenyl-1,3-dioxan-5-ol (PubChem CID 25178781) has the molecular formula C16H24O4S2 and a molecular weight of 344.50 g/mol. Its IUPAC name is (2R,4R,5S,6R)-4-[bis(ethylsulfanyl)methyl]-6-(hydroxymethyl)-2-phenyl-1,3-dioxan-5-ol.
| Compound Name | (2R,4R,5S,6R)-4-[bis(ethylsulfanyl)methyl]-6-(hydroxymethyl)-2-phenyl-1,3-dioxan-5-ol |
|---|---|
| PubChem CID | 25178781 |
| Molecular Formula | C16H24O4S2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | (2R,4R,5S,6R)-4-[bis(ethylsulfanyl)methyl]-6-(hydroxymethyl)-2-phenyl-1,3-dioxan-5-ol |
| SMILES | CCSC(SCC)[C@@H]1O[C@H](c2ccccc2)O[C@H](CO)[C@@H]1O |
| InChI | InChI=1S/C16H24O4S2/c1-3-21-16(22-4-2)14-13(18)12(10-17)19-15(20-14)11-8-6-5-7-9-11/h5-9,12-18H,3-4,10H2,1-2H3/t12-,13+,14-,15-/m1/s1 |
| InChIKey | VOZMUPPJOWINOC-LXTVHRRPSA-N |
| XLogP | 2.65 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|