About 6-chloro-N-[(3,4-difluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)quinazolin-4-amine
6-chloro-N-[(3,4-difluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)quinazolin-4-amine (PubChem CID 25179122) has the molecular formula C20H20ClF2N5
and a molecular weight of 403.86 g/mol. Its IUPAC name is 6-chloro-N-[(3,4-difluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)quinazolin-4-amine.
Molecular Properties
| Compound Name | 6-chloro-N-[(3,4-difluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)quinazolin-4-amine |
| PubChem CID | 25179122 |
| Molecular Formula | C20H20ClF2N5 |
| Molecular Weight | 403.86 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 6-chloro-N-[(3,4-difluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)quinazolin-4-amine |
| SMILES | CN1CCN(c2nc(NCc3ccc(F)c(F)c3)c3cc(Cl)ccc3n2)CC1 |
| InChI | InChI=1S/C20H20ClF2N5/c1-27-6-8-28(9-7-27)20-25-18-5-3-14(21)11-15(18)19(26-20)24-12-13-2-4-16(22)17(23)10-13/h2-5,10-11H,6-9,12H2,1H3,(H,24,25,26) |
| InChIKey | SMKOZZWIBRGRQG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.86 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-N-[(3,4-difluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-[(3,4-difluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)quinazolin-4-amine?
The IUPAC name of 6-chloro-N-[(3,4-difluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)quinazolin-4-amine (CID 25179122) is 6-chloro-N-[(3,4-difluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)quinazolin-4-amine.
What is the SMILES notation for 6-chloro-N-[(3,4-difluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)quinazolin-4-amine?
The canonical SMILES for 6-chloro-N-[(3,4-difluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)quinazolin-4-amine is CN1CCN(c2nc(NCc3ccc(F)c(F)c3)c3cc(Cl)ccc3n2)CC1.
What is the InChIKey of 6-chloro-N-[(3,4-difluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)quinazolin-4-amine?
The InChIKey is SMKOZZWIBRGRQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20ClF2N5/c1-27-6-8-28(9-7-27)20-25-18-5-3-14(21)11-15(18)19(26-20)24-12-13-2-4-16(22)17(23)10-13/h2-5,10-11H,6-9,12H2,1H3,(H,24,25,26).
What are the key properties of 6-chloro-N-[(3,4-difluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)quinazolin-4-amine?
6-chloro-N-[(3,4-difluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)quinazolin-4-amine has a molecular weight of 403.86 g/mol, XLogP of 3.93, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-[(3,4-difluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)quinazolin-4-amine is sourced from PubChem (CID 25179122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).