C19H17FN2O4S — CID 25179143
1-[(4-fluorophenyl)methyl]-5-pyrrolidin-1-ylsulfonylindole-2,3-dione (PubChem CID 25179143) has the molecular formula C19H17FN2O4S and a molecular weight of 388.42 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-5-pyrrolidin-1-ylsulfonylindole-2,3-dione.
| Compound Name | 1-[(4-fluorophenyl)methyl]-5-pyrrolidin-1-ylsulfonylindole-2,3-dione |
|---|---|
| PubChem CID | 25179143 |
| Molecular Formula | C19H17FN2O4S |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-5-pyrrolidin-1-ylsulfonylindole-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2ccc(F)cc2)c2ccc(S(=O)(=O)N3CCCC3)cc21 |
| InChI | InChI=1S/C19H17FN2O4S/c20-14-5-3-13(4-6-14)12-22-17-8-7-15(11-16(17)18(23)19(22)24)27(25,26)21-9-1-2-10-21/h3-8,11H,1-2,9-10,12H2 |
| InChIKey | XMBJTDKKHXHJMK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|