C13H13NO8 — CID 25179315
[(3R,3aR,6S,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-hydroxybenzoate (PubChem CID 25179315) has the molecular formula C13H13NO8 and a molecular weight of 311.25 g/mol. Its IUPAC name is [(3R,3aR,6S,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-hydroxybenzoate.
| Compound Name | [(3R,3aR,6S,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 25179315 |
| Molecular Formula | C13H13NO8 |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | [(3R,3aR,6S,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-hydroxybenzoate |
| SMILES | O=C(O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2O[N+](=O)[O-])c1ccccc1O |
| InChI | InChI=1S/C13H13NO8/c15-8-4-2-1-3-7(8)13(16)21-9-5-19-12-10(22-14(17)18)6-20-11(9)12/h1-4,9-12,15H,5-6H2/t9-,10+,11-,12-/m1/s1 |
| InChIKey | HRGCZOFVFVBTEL-WRWGMCAJSA-N |
| XLogP | 0.29 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|