About 1-(2-bromophenyl)ethyl 2-methoxynaphthalene-1-sulfonate
1-(2-bromophenyl)ethyl 2-methoxynaphthalene-1-sulfonate (PubChem CID 25179425) has the molecular formula C19H17BrO4S
and a molecular weight of 421.31 g/mol. Its IUPAC name is 1-(2-bromophenyl)ethyl 2-methoxynaphthalene-1-sulfonate.
Molecular Properties
| Compound Name | 1-(2-bromophenyl)ethyl 2-methoxynaphthalene-1-sulfonate |
| PubChem CID | 25179425 |
| Molecular Formula | C19H17BrO4S |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.00 |
| IUPAC Name | 1-(2-bromophenyl)ethyl 2-methoxynaphthalene-1-sulfonate |
| SMILES | COc1ccc2ccccc2c1S(=O)(=O)OC(C)c1ccccc1Br |
| InChI | InChI=1S/C19H17BrO4S/c1-13(15-8-5-6-10-17(15)20)24-25(21,22)19-16-9-4-3-7-14(16)11-12-18(19)23-2/h3-13H,1-2H3 |
| InChIKey | HLTMCPFELUBRMF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-bromophenyl)ethyl 2-methoxynaphthalene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromophenyl)ethyl 2-methoxynaphthalene-1-sulfonate?
The IUPAC name of 1-(2-bromophenyl)ethyl 2-methoxynaphthalene-1-sulfonate (CID 25179425) is 1-(2-bromophenyl)ethyl 2-methoxynaphthalene-1-sulfonate.
What is the SMILES notation for 1-(2-bromophenyl)ethyl 2-methoxynaphthalene-1-sulfonate?
The canonical SMILES for 1-(2-bromophenyl)ethyl 2-methoxynaphthalene-1-sulfonate is COc1ccc2ccccc2c1S(=O)(=O)OC(C)c1ccccc1Br.
What is the InChIKey of 1-(2-bromophenyl)ethyl 2-methoxynaphthalene-1-sulfonate?
The InChIKey is HLTMCPFELUBRMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17BrO4S/c1-13(15-8-5-6-10-17(15)20)24-25(21,22)19-16-9-4-3-7-14(16)11-12-18(19)23-2/h3-13H,1-2H3.
What are the key properties of 1-(2-bromophenyl)ethyl 2-methoxynaphthalene-1-sulfonate?
1-(2-bromophenyl)ethyl 2-methoxynaphthalene-1-sulfonate has a molecular weight of 421.31 g/mol, XLogP of 5.08, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromophenyl)ethyl 2-methoxynaphthalene-1-sulfonate is sourced from PubChem (CID 25179425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).