C27H42N4O3 — CID 25179470
6-[8-(1,2,3,4-tetrahydroacridin-9-ylamino)octylamino]hexyl nitrate (PubChem CID 25179470) has the molecular formula C27H42N4O3 and a molecular weight of 470.66 g/mol. Its IUPAC name is 6-[8-(1,2,3,4-tetrahydroacridin-9-ylamino)octylamino]hexyl nitrate.
| Compound Name | 6-[8-(1,2,3,4-tetrahydroacridin-9-ylamino)octylamino]hexyl nitrate |
|---|---|
| PubChem CID | 25179470 |
| Molecular Formula | C27H42N4O3 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.33 |
| IUPAC Name | 6-[8-(1,2,3,4-tetrahydroacridin-9-ylamino)octylamino]hexyl nitrate |
| SMILES | O=[N+]([O-])OCCCCCCNCCCCCCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C27H42N4O3/c32-31(33)34-22-14-6-5-12-20-28-19-11-3-1-2-4-13-21-29-27-23-15-7-9-17-25(23)30-26-18-10-8-16-24(26)27/h7,9,15,17,28H,1-6,8,10-14,16,18-22H2,(H,29,30) |
| InChIKey | YLCSZNBZZQPVCZ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|