C15H24O3 — CID 25179734
(1aS,3R,3aR,7S,7aS,7bR)-3,3a-dihydroxy-1,1,7,7a-tetramethyl-3,4,5,6,7,7b-hexahydro-1aH-cyclopropa[a]naphthalen-2-one (PubChem CID 25179734) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (1aS,3R,3aR,7S,7aS,7bR)-3,3a-dihydroxy-1,1,7,7a-tetramethyl-3,4,5,6,7,7b-hexahydro-1aH-cyclopropa[a]naphthalen-2-one.
| Compound Name | (1aS,3R,3aR,7S,7aS,7bR)-3,3a-dihydroxy-1,1,7,7a-tetramethyl-3,4,5,6,7,7b-hexahydro-1aH-cyclopropa[a]naphthalen-2-one |
|---|---|
| PubChem CID | 25179734 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (1aS,3R,3aR,7S,7aS,7bR)-3,3a-dihydroxy-1,1,7,7a-tetramethyl-3,4,5,6,7,7b-hexahydro-1aH-cyclopropa[a]naphthalen-2-one |
| SMILES | C[C@H]1CCC[C@]2(O)[C@@H](O)C(=O)[C@H]3[C@H](C3(C)C)[C@]12C |
| InChI | InChI=1S/C15H24O3/c1-8-6-5-7-15(18)12(17)10(16)9-11(13(9,2)3)14(8,15)4/h8-9,11-12,17-18H,5-7H2,1-4H3/t8-,9-,11+,12-,14-,15-/m0/s1 |
| InChIKey | YIZZSHZWGWWBGE-GUGUHVSSSA-N |
| XLogP | 1.76 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |