C17H30O — CID 25179794
heptadeca-1,5,6-trien-4-ol (PubChem CID 25179794) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is heptadeca-1,5,6-trien-4-ol.
| Compound Name | heptadeca-1,5,6-trien-4-ol |
|---|---|
| PubChem CID | 25179794 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | heptadeca-1,5,6-trien-4-ol |
| SMILES | C=CCC(O)C=C=CCCCCCCCCCC |
| InChI | InChI=1S/C17H30O/c1-3-5-6-7-8-9-10-11-12-13-14-16-17(18)15-4-2/h4,13,16-18H,2-3,5-12,15H2,1H3 |
| InChIKey | CQQYHSVWEDKKKC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|