About 2-[4,6-bis(2-phenylethoxy)pyrimidin-2-yl]sulfanylhexanoic acid
2-[4,6-bis(2-phenylethoxy)pyrimidin-2-yl]sulfanylhexanoic acid (PubChem CID 25179907) has the molecular formula C26H30N2O4S
and a molecular weight of 466.60 g/mol. Its IUPAC name is 2-[4,6-bis(2-phenylethoxy)pyrimidin-2-yl]sulfanylhexanoic acid.
Molecular Properties
| Compound Name | 2-[4,6-bis(2-phenylethoxy)pyrimidin-2-yl]sulfanylhexanoic acid |
| PubChem CID | 25179907 |
| Molecular Formula | C26H30N2O4S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 2-[4,6-bis(2-phenylethoxy)pyrimidin-2-yl]sulfanylhexanoic acid |
| SMILES | CCCCC(Sc1nc(OCCc2ccccc2)cc(OCCc2ccccc2)n1)C(=O)O |
| InChI | InChI=1S/C26H30N2O4S/c1-2-3-14-22(25(29)30)33-26-27-23(31-17-15-20-10-6-4-7-11-20)19-24(28-26)32-18-16-21-12-8-5-9-13-21/h4-13,19,22H,2-3,14-18H2,1H3,(H,29,30) |
| InChIKey | KYRBYBXVVWQIJQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4,6-bis(2-phenylethoxy)pyrimidin-2-yl]sulfanylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4,6-bis(2-phenylethoxy)pyrimidin-2-yl]sulfanylhexanoic acid?
The IUPAC name of 2-[4,6-bis(2-phenylethoxy)pyrimidin-2-yl]sulfanylhexanoic acid (CID 25179907) is 2-[4,6-bis(2-phenylethoxy)pyrimidin-2-yl]sulfanylhexanoic acid.
What is the SMILES notation for 2-[4,6-bis(2-phenylethoxy)pyrimidin-2-yl]sulfanylhexanoic acid?
The canonical SMILES for 2-[4,6-bis(2-phenylethoxy)pyrimidin-2-yl]sulfanylhexanoic acid is CCCCC(Sc1nc(OCCc2ccccc2)cc(OCCc2ccccc2)n1)C(=O)O.
What is the InChIKey of 2-[4,6-bis(2-phenylethoxy)pyrimidin-2-yl]sulfanylhexanoic acid?
The InChIKey is KYRBYBXVVWQIJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30N2O4S/c1-2-3-14-22(25(29)30)33-26-27-23(31-17-15-20-10-6-4-7-11-20)19-24(28-26)32-18-16-21-12-8-5-9-13-21/h4-13,19,22H,2-3,14-18H2,1H3,(H,29,30).
What are the key properties of 2-[4,6-bis(2-phenylethoxy)pyrimidin-2-yl]sulfanylhexanoic acid?
2-[4,6-bis(2-phenylethoxy)pyrimidin-2-yl]sulfanylhexanoic acid has a molecular weight of 466.60 g/mol, XLogP of 5.46, 14 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4,6-bis(2-phenylethoxy)pyrimidin-2-yl]sulfanylhexanoic acid is sourced from PubChem (CID 25179907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).