C15H20O2 — CID 25179928
(2R,4S,5S,7R,8S,9S)-6,6,8,9-tetramethyl-3-oxatetracyclo[6.4.0.02,4.05,7]dodec-1(12)-en-11-one (PubChem CID 25179928) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (2R,4S,5S,7R,8S,9S)-6,6,8,9-tetramethyl-3-oxatetracyclo[6.4.0.02,4.05,7]dodec-1(12)-en-11-one.
| Compound Name | (2R,4S,5S,7R,8S,9S)-6,6,8,9-tetramethyl-3-oxatetracyclo[6.4.0.02,4.05,7]dodec-1(12)-en-11-one |
|---|---|
| PubChem CID | 25179928 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (2R,4S,5S,7R,8S,9S)-6,6,8,9-tetramethyl-3-oxatetracyclo[6.4.0.02,4.05,7]dodec-1(12)-en-11-one |
| SMILES | C[C@H]1CC(=O)C=C2[C@H]3O[C@H]3[C@H]3[C@H](C3(C)C)[C@@]21C |
| InChI | InChI=1S/C15H20O2/c1-7-5-8(16)6-9-11-12(17-11)10-13(14(10,2)3)15(7,9)4/h6-7,10-13H,5H2,1-4H3/t7-,10-,11+,12-,13+,15+/m0/s1 |
| InChIKey | VWHKRJDIXZCEGF-YAHBZEKOSA-N |
| XLogP | 2.58 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|