C17H28O4 — CID 25180127
[(7E)-6,10-dihydroxy-2,6,10-trimethyldodeca-1,7,11-trien-3-yl] acetate (PubChem CID 25180127) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is [(7E)-6,10-dihydroxy-2,6,10-trimethyldodeca-1,7,11-trien-3-yl] acetate.
| Compound Name | [(7E)-6,10-dihydroxy-2,6,10-trimethyldodeca-1,7,11-trien-3-yl] acetate |
|---|---|
| PubChem CID | 25180127 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | [(7E)-6,10-dihydroxy-2,6,10-trimethyldodeca-1,7,11-trien-3-yl] acetate |
| SMILES | C=CC(C)(O)C/C=C/C(C)(O)CCC(OC(C)=O)C(=C)C |
| InChI | InChI=1S/C17H28O4/c1-7-16(5,19)10-8-11-17(6,20)12-9-15(13(2)3)21-14(4)18/h7-8,11,15,19-20H,1-2,9-10,12H2,3-6H3/b11-8+ |
| InChIKey | VUYGYGVRRRWIRQ-DHZHZOJOSA-N |
| XLogP | 2.91 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|